C15H13Cl2NO3S — CID 143624782
2-(2,3-dichloro-N-(4-methylphenyl)sulfinylanilino)acetic acid (PubChem CID 143624782) has the molecular formula C15H13Cl2NO3S and a molecular weight of 358.25 g/mol. Its IUPAC name is 2-(2,3-dichloro-N-(4-methylphenyl)sulfinylanilino)acetic acid.
| Compound Name | 2-(2,3-dichloro-N-(4-methylphenyl)sulfinylanilino)acetic acid |
|---|---|
| PubChem CID | 143624782 |
| Molecular Formula | C15H13Cl2NO3S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-(2,3-dichloro-N-(4-methylphenyl)sulfinylanilino)acetic acid |
| SMILES | Cc1ccc(S(=O)N(CC(=O)O)c2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2NO3S/c1-10-5-7-11(8-6-10)22(21)18(9-14(19)20)13-4-2-3-12(16)15(13)17/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | HLINHVMNGJRWDR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |