C23H29ClN2O2S — CID 143624883
2-(3-chloro-N-cyclohexylsulfanyl-2-methylanilino)-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 143624883) has the molecular formula C23H29ClN2O2S and a molecular weight of 433.02 g/mol. Its IUPAC name is 2-(3-chloro-N-cyclohexylsulfanyl-2-methylanilino)-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-(3-chloro-N-cyclohexylsulfanyl-2-methylanilino)-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 143624883 |
| Molecular Formula | C23H29ClN2O2S |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-(3-chloro-N-cyclohexylsulfanyl-2-methylanilino)-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)CN(SC2CCCCC2)c2cccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C23H29ClN2O2S/c1-17-21(24)9-6-10-22(17)26(29-20-7-4-3-5-8-20)16-23(27)25-15-18-11-13-19(28-2)14-12-18/h6,9-14,20H,3-5,7-8,15-16H2,1-2H3,(H,25,27) |
| InChIKey | GYGZJRMNQJAJNH-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|