C13H16FNO — CID 143625149
(7E)-4-fluoro-7-formyl-2,2-dimethyl-3-methylidenenona-4,7-dienenitrile (PubChem CID 143625149) has the molecular formula C13H16FNO and a molecular weight of 221.27 g/mol. Its IUPAC name is (7E)-4-fluoro-7-formyl-2,2-dimethyl-3-methylidenenona-4,7-dienenitrile.
| Compound Name | (7E)-4-fluoro-7-formyl-2,2-dimethyl-3-methylidenenona-4,7-dienenitrile |
|---|---|
| PubChem CID | 143625149 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (7E)-4-fluoro-7-formyl-2,2-dimethyl-3-methylidenenona-4,7-dienenitrile |
| SMILES | C=C(C(F)=CC/C(C=O)=C\C)C(C)(C)C#N |
| InChI | InChI=1S/C13H16FNO/c1-5-11(8-16)6-7-12(14)10(2)13(3,4)9-15/h5,7-8H,2,6H2,1,3-4H3/b11-5+,12-7? |
| InChIKey | HHMRFBWYTAPREF-QYSZPDDDSA-N |
| XLogP | 3.48 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|