C17H19F3N2O3 — CID 143627574
ethane;ethyl 2-[[2-(trifluoromethyl)quinoline-5-carbonyl]amino]acetate (PubChem CID 143627574) has the molecular formula C17H19F3N2O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is ethane;ethyl 2-[[2-(trifluoromethyl)quinoline-5-carbonyl]amino]acetate.
| Compound Name | ethane;ethyl 2-[[2-(trifluoromethyl)quinoline-5-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 143627574 |
| Molecular Formula | C17H19F3N2O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | ethane;ethyl 2-[[2-(trifluoromethyl)quinoline-5-carbonyl]amino]acetate |
| SMILES | CC.CCOC(=O)CNC(=O)c1cccc2nc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C15H13F3N2O3.C2H6/c1-2-23-13(21)8-19-14(22)10-4-3-5-11-9(10)6-7-12(20-11)15(16,17)18;1-2/h3-7H,2,8H2,1H3,(H,19,22);1-2H3 |
| InChIKey | RJVXDOKOBCYJOQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |