C25H30ClF3N2O — CID 143629429
4-butan-2-yl-1-methylpyrrolidin-2-one;2-chloro-4-methylbenzonitrile;1-ethyl-2,4,5-trifluorobenzene (PubChem CID 143629429) has the molecular formula C25H30ClF3N2O and a molecular weight of 466.98 g/mol. Its IUPAC name is 4-butan-2-yl-1-methylpyrrolidin-2-one;2-chloro-4-methylbenzonitrile;1-ethyl-2,4,5-trifluorobenzene.
| Compound Name | 4-butan-2-yl-1-methylpyrrolidin-2-one;2-chloro-4-methylbenzonitrile;1-ethyl-2,4,5-trifluorobenzene |
|---|---|
| PubChem CID | 143629429 |
| Molecular Formula | C25H30ClF3N2O |
| Molecular Weight | 466.98 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 4-butan-2-yl-1-methylpyrrolidin-2-one;2-chloro-4-methylbenzonitrile;1-ethyl-2,4,5-trifluorobenzene |
| SMILES | CCC(C)C1CC(=O)N(C)C1.CCc1cc(F)c(F)cc1F.Cc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C9H17NO.C8H6ClN.C8H7F3/c1-4-7(2)8-5-9(11)10(3)6-8;1-6-2-3-7(5-10)8(9)4-6;1-2-5-3-7(10)8(11)4-6(5)9/h7-8H,4-6H2,1-3H3;2-4H,1H3;3-4H,2H2,1H3 |
| InChIKey | BGOWLORVWYMMOE-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.98 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|