potassium 4-pyrrolidin-1-id-2-ylpyridine

C9H11KN2 — CID 143629820

IUPACpotassium 4-pyrrolidin-1-id-2-ylpyridine
SMILES[K+].c1cc(C2CCC[N-]2)ccn1
InChIInChI=1S/C9H11N2.K/c1-2-9(11-5-1)8-3-6-10-7-4-8;/h3-4,6-7,9H,1-2,5H2;/q-1;+1
InChIKeySWKGCKFJTAVCSW-UHFFFAOYSA-N
MW186.30 g/mol
LogP-0.71
Rot. Bonds1

About potassium 4-pyrrolidin-1-id-2-ylpyridine

potassium 4-pyrrolidin-1-id-2-ylpyridine (PubChem CID 143629820) has the molecular formula C9H11KN2 and a molecular weight of 186.30 g/mol. Its IUPAC name is potassium 4-pyrrolidin-1-id-2-ylpyridine.

Molecular Properties

Compound Namepotassium 4-pyrrolidin-1-id-2-ylpyridine
PubChem CID143629820
Molecular FormulaC9H11KN2
Molecular Weight186.30 g/mol
Exact Mass186.06
IUPAC Namepotassium 4-pyrrolidin-1-id-2-ylpyridine
SMILES[K+].c1cc(C2CCC[N-]2)ccn1
InChIInChI=1S/C9H11N2.K/c1-2-9(11-5-1)8-3-6-10-7-4-8;/h3-4,6-7,9H,1-2,5H2;/q-1;+1
InChIKeySWKGCKFJTAVCSW-UHFFFAOYSA-N
XLogP-0.71
TPSA26.99 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.30
LogP ≤ 5-0.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze potassium 4-pyrrolidin-1-id-2-ylpyridine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 4-pyrrolidin-1-id-2-ylpyridine?
The IUPAC name of potassium 4-pyrrolidin-1-id-2-ylpyridine (CID 143629820) is potassium 4-pyrrolidin-1-id-2-ylpyridine.
What is the SMILES notation for potassium 4-pyrrolidin-1-id-2-ylpyridine?
The canonical SMILES for potassium 4-pyrrolidin-1-id-2-ylpyridine is [K+].c1cc(C2CCC[N-]2)ccn1.
What is the InChIKey of potassium 4-pyrrolidin-1-id-2-ylpyridine?
The InChIKey is SWKGCKFJTAVCSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N2.K/c1-2-9(11-5-1)8-3-6-10-7-4-8;/h3-4,6-7,9H,1-2,5H2;/q-1;+1.
What are the key properties of potassium 4-pyrrolidin-1-id-2-ylpyridine?
potassium 4-pyrrolidin-1-id-2-ylpyridine has a molecular weight of 186.30 g/mol, XLogP of -0.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 4-pyrrolidin-1-id-2-ylpyridine is sourced from PubChem (CID 143629820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).