C25H38N2S — CID 143631346
(7-methyl-9H-fluoren-2-yl)thiourea;bis(pentane) (PubChem CID 143631346) has the molecular formula C25H38N2S and a molecular weight of 398.66 g/mol. Its IUPAC name is (7-methyl-9H-fluoren-2-yl)thiourea;bis(pentane).
| Compound Name | (7-methyl-9H-fluoren-2-yl)thiourea;bis(pentane) |
|---|---|
| PubChem CID | 143631346 |
| Molecular Formula | C25H38N2S |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (7-methyl-9H-fluoren-2-yl)thiourea;bis(pentane) |
| SMILES | CCCCC.CCCCC.Cc1ccc2c(c1)Cc1cc(NC(N)=S)ccc1-2 |
| InChI | InChI=1S/C15H14N2S.2C5H12/c1-9-2-4-13-10(6-9)7-11-8-12(17-15(16)18)3-5-14(11)13;2*1-3-5-4-2/h2-6,8H,7H2,1H3,(H3,16,17,18);2*3-5H2,1-2H3 |
| InChIKey | ATDHEKREWRJWHD-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|