C17H15N3S2 — CID 58121386
3-(7-isothiocyanato-9H-fluoren-2-yl)-1,1-dimethylthiourea (PubChem CID 58121386) has the molecular formula C17H15N3S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 3-(7-isothiocyanato-9H-fluoren-2-yl)-1,1-dimethylthiourea.
| Compound Name | 3-(7-isothiocyanato-9H-fluoren-2-yl)-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 58121386 |
| Molecular Formula | C17H15N3S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 3-(7-isothiocyanato-9H-fluoren-2-yl)-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)Nc1ccc2c(c1)Cc1cc(N=C=S)ccc1-2 |
| InChI | InChI=1S/C17H15N3S2/c1-20(2)17(22)19-14-4-6-16-12(9-14)7-11-8-13(18-10-21)3-5-15(11)16/h3-6,8-9H,7H2,1-2H3,(H,19,22) |
| InChIKey | SVAJTDSUTFZVNZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|