C33H20ClN9O4 — CID 58098560
[7-[[4-chloro-6-[(7-isocyanato-9H-fluoren-2-yl)carbamoylamino]-1,3,5-triazin-2-yl]carbamoylamino]-9H-fluoren-2-yl] cyanate (PubChem CID 58098560) has the molecular formula C33H20ClN9O4 and a molecular weight of 642.04 g/mol. Its IUPAC name is [7-[[4-chloro-6-[(7-isocyanato-9H-fluoren-2-yl)carbamoylamino]-1,3,5-triazin-2-yl]carbamoylamino]-9H-fluoren-2-yl] cyanate.
| Compound Name | [7-[[4-chloro-6-[(7-isocyanato-9H-fluoren-2-yl)carbamoylamino]-1,3,5-triazin-2-yl]carbamoylamino]-9H-fluoren-2-yl] cyanate |
|---|---|
| PubChem CID | 58098560 |
| Molecular Formula | C33H20ClN9O4 |
| Molecular Weight | 642.04 g/mol |
| Exact Mass | 641.13 |
| IUPAC Name | [7-[[4-chloro-6-[(7-isocyanato-9H-fluoren-2-yl)carbamoylamino]-1,3,5-triazin-2-yl]carbamoylamino]-9H-fluoren-2-yl] cyanate |
| SMILES | N#COc1ccc2c(c1)Cc1cc(NC(=O)Nc3nc(Cl)nc(NC(=O)Nc4ccc5c(c4)Cc4cc(N=C=O)ccc4-5)n3)ccc1-2 |
| InChI | InChI=1S/C33H20ClN9O4/c34-29-39-30(42-32(45)37-22-2-6-26-18(12-22)9-17-11-21(36-16-44)1-5-25(17)26)41-31(40-29)43-33(46)38-23-3-7-27-19(13-23)10-20-14-24(47-15-35)4-8-28(20)27/h1-8,11-14H,9-10H2,(H4,37,38,39,40,41,42,43,45,46) |
| InChIKey | QLNGSMAIGYVTEP-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 183.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.04 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|