C31H33N2O2P — CID 143631738
9-[2-(benzylamino)prop-2-enyl]-3-(3-methyl-4-phenylphenyl)-4-phosphanyl-1-oxa-9-azaspiro[4.5]dec-3-en-2-one (PubChem CID 143631738) has the molecular formula C31H33N2O2P and a molecular weight of 496.59 g/mol. Its IUPAC name is 9-[2-(benzylamino)prop-2-enyl]-3-(3-methyl-4-phenylphenyl)-4-phosphanyl-1-oxa-9-azaspiro[4.5]dec-3-en-2-one.
| Compound Name | 9-[2-(benzylamino)prop-2-enyl]-3-(3-methyl-4-phenylphenyl)-4-phosphanyl-1-oxa-9-azaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 143631738 |
| Molecular Formula | C31H33N2O2P |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 9-[2-(benzylamino)prop-2-enyl]-3-(3-methyl-4-phenylphenyl)-4-phosphanyl-1-oxa-9-azaspiro[4.5]dec-3-en-2-one |
| SMILES | C=C(CN1CCCC2(C1)OC(=O)C(c1ccc(-c3ccccc3)c(C)c1)=C2P)NCc1ccccc1 |
| InChI | InChI=1S/C31H33N2O2P/c1-22-18-26(14-15-27(22)25-12-7-4-8-13-25)28-29(36)31(35-30(28)34)16-9-17-33(21-31)20-23(2)32-19-24-10-5-3-6-11-24/h3-8,10-15,18,32H,2,9,16-17,19-21,36H2,1H3 |
| InChIKey | YLGUOGBMGZMAHT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|