C26H44N4O3S — CID 143632261
N-[2-[2-(dimethylamino)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-6-yl]-3-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]propanamide (PubChem CID 143632261) has the molecular formula C26H44N4O3S and a molecular weight of 492.73 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-6-yl]-3-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]propanamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-6-yl]-3-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]propanamide |
|---|---|
| PubChem CID | 143632261 |
| Molecular Formula | C26H44N4O3S |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-6-yl]-3-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]propanamide |
| SMILES | COc1cc(C)c(S(=O)N(C)CCC(=O)NC2CCC3CN(CCN(C)C)CCC3C2)c(C)c1 |
| InChI | InChI=1S/C26H44N4O3S/c1-19-15-24(33-6)16-20(2)26(19)34(32)29(5)11-10-25(31)27-23-8-7-22-18-30(14-13-28(3)4)12-9-21(22)17-23/h15-16,21-23H,7-14,17-18H2,1-6H3,(H,27,31) |
| InChIKey | MCWCMUSNQWGHKP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |