C23H22N2O4 — CID 143636410
2-[[3-[(3,4-dimethylanilino)-hydroxymethyl]phenyl]carbamoyl]benzoic acid (PubChem CID 143636410) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[[3-[(3,4-dimethylanilino)-hydroxymethyl]phenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[3-[(3,4-dimethylanilino)-hydroxymethyl]phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 143636410 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-[[3-[(3,4-dimethylanilino)-hydroxymethyl]phenyl]carbamoyl]benzoic acid |
| SMILES | Cc1ccc(NC(O)c2cccc(NC(=O)c3ccccc3C(=O)O)c2)cc1C |
| InChI | InChI=1S/C23H22N2O4/c1-14-10-11-18(12-15(14)2)24-21(26)16-6-5-7-17(13-16)25-22(27)19-8-3-4-9-20(19)23(28)29/h3-13,21,24,26H,1-2H3,(H,25,27)(H,28,29) |
| InChIKey | WRUFAEPZSNWHEP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|