C22H21N5O2 — CID 143638328
1-[5-anilino-3-(2-methoxyethylamino)pyrimido[4,5-c]quinolin-8-yl]ethanone (PubChem CID 143638328) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-[5-anilino-3-(2-methoxyethylamino)pyrimido[4,5-c]quinolin-8-yl]ethanone.
| Compound Name | 1-[5-anilino-3-(2-methoxyethylamino)pyrimido[4,5-c]quinolin-8-yl]ethanone |
|---|---|
| PubChem CID | 143638328 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-[5-anilino-3-(2-methoxyethylamino)pyrimido[4,5-c]quinolin-8-yl]ethanone |
| SMILES | COCCNc1ncc2c(n1)c(Nc1ccccc1)nc1cc(C(C)=O)ccc12 |
| InChI | InChI=1S/C22H21N5O2/c1-14(28)15-8-9-17-18-13-24-22(23-10-11-29-2)27-20(18)21(26-19(17)12-15)25-16-6-4-3-5-7-16/h3-9,12-13H,10-11H2,1-2H3,(H,25,26)(H,23,24,27) |
| InChIKey | MDMMFYSSBOHKHJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|