C23H17N5O2 — CID 53326159
3-(cyclopropylamino)-5-(3-ethynylanilino)pyrimido[4,5-c]quinoline-8-carboxylic acid (PubChem CID 53326159) has the molecular formula C23H17N5O2 and a molecular weight of 395.42 g/mol. Its IUPAC name is 3-(cyclopropylamino)-5-(3-ethynylanilino)pyrimido[4,5-c]quinoline-8-carboxylic acid.
| Compound Name | 3-(cyclopropylamino)-5-(3-ethynylanilino)pyrimido[4,5-c]quinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 53326159 |
| Molecular Formula | C23H17N5O2 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 3-(cyclopropylamino)-5-(3-ethynylanilino)pyrimido[4,5-c]quinoline-8-carboxylic acid |
| SMILES | C#Cc1cccc(Nc2nc3cc(C(=O)O)ccc3c3cnc(NC4CC4)nc23)c1 |
| InChI | InChI=1S/C23H17N5O2/c1-2-13-4-3-5-16(10-13)25-21-20-18(12-24-23(28-20)26-15-7-8-15)17-9-6-14(22(29)30)11-19(17)27-21/h1,3-6,9-12,15H,7-8H2,(H,25,27)(H,29,30)(H,24,26,28) |
| InChIKey | SVWAQVCRWITFIA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|