C19H19N7 — CID 19709082
4-N-(3-ethynylphenyl)-6-N-piperidin-4-ylpyrimido[5,4-d]pyrimidine-4,6-diamine (PubChem CID 19709082) has the molecular formula C19H19N7 and a molecular weight of 345.41 g/mol. Its IUPAC name is 4-N-(3-ethynylphenyl)-6-N-piperidin-4-ylpyrimido[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-ethynylphenyl)-6-N-piperidin-4-ylpyrimido[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 19709082 |
| Molecular Formula | C19H19N7 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 4-N-(3-ethynylphenyl)-6-N-piperidin-4-ylpyrimido[5,4-d]pyrimidine-4,6-diamine |
| SMILES | C#Cc1cccc(Nc2ncnc3cnc(NC4CCNCC4)nc23)c1 |
| InChI | InChI=1S/C19H19N7/c1-2-13-4-3-5-15(10-13)24-18-17-16(22-12-23-18)11-21-19(26-17)25-14-6-8-20-9-7-14/h1,3-5,10-12,14,20H,6-9H2,(H,21,25,26)(H,22,23,24) |
| InChIKey | JBPIOJDKUQRWKU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|