C30H31N5O3 — CID 122437203
benzyl formate;4-N-(3-ethynylphenyl)-7-methoxy-6-N-piperidin-4-ylquinazoline-4,6-diamine (PubChem CID 122437203) has the molecular formula C30H31N5O3 and a molecular weight of 509.61 g/mol. Its IUPAC name is benzyl formate;4-N-(3-ethynylphenyl)-7-methoxy-6-N-piperidin-4-ylquinazoline-4,6-diamine.
| Compound Name | benzyl formate;4-N-(3-ethynylphenyl)-7-methoxy-6-N-piperidin-4-ylquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 122437203 |
| Molecular Formula | C30H31N5O3 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | benzyl formate;4-N-(3-ethynylphenyl)-7-methoxy-6-N-piperidin-4-ylquinazoline-4,6-diamine |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(NC4CCNCC4)cc23)c1.O=COCc1ccccc1 |
| InChI | InChI=1S/C22H23N5O.C8H8O2/c1-3-15-5-4-6-17(11-15)27-22-18-12-20(26-16-7-9-23-10-8-16)21(28-2)13-19(18)24-14-25-22;9-7-10-6-8-4-2-1-3-5-8/h1,4-6,11-14,16,23,26H,7-10H2,2H3,(H,24,25,27);1-5,7H,6H2 |
| InChIKey | MZJBGIQNKXILLJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|