C23H26N8O3 — CID 19709437
[4-[[4-(3-nitroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]cyclohexyl]-pyrrolidin-1-ylmethanone (PubChem CID 19709437) has the molecular formula C23H26N8O3 and a molecular weight of 462.51 g/mol. Its IUPAC name is [4-[[4-(3-nitroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]cyclohexyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[[4-(3-nitroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]cyclohexyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 19709437 |
| Molecular Formula | C23H26N8O3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | [4-[[4-(3-nitroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]cyclohexyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1CCC(Nc2ncc3ncnc(Nc4cccc([N+](=O)[O-])c4)c3n2)CC1)N1CCCC1 |
| InChI | InChI=1S/C23H26N8O3/c32-22(30-10-1-2-11-30)15-6-8-16(9-7-15)28-23-24-13-19-20(29-23)21(26-14-25-19)27-17-4-3-5-18(12-17)31(33)34/h3-5,12-16H,1-2,6-11H2,(H,24,28,29)(H,25,26,27) |
| InChIKey | YLSOTOSANMJSHP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 139.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|