C18H20N8O3 — CID 19709275
6-N-(2-morpholin-4-ylethyl)-4-N-(3-nitrophenyl)pyrimido[5,4-d]pyrimidine-4,6-diamine (PubChem CID 19709275) has the molecular formula C18H20N8O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is 6-N-(2-morpholin-4-ylethyl)-4-N-(3-nitrophenyl)pyrimido[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 6-N-(2-morpholin-4-ylethyl)-4-N-(3-nitrophenyl)pyrimido[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 19709275 |
| Molecular Formula | C18H20N8O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 6-N-(2-morpholin-4-ylethyl)-4-N-(3-nitrophenyl)pyrimido[5,4-d]pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1cccc(Nc2ncnc3cnc(NCCN4CCOCC4)nc23)c1 |
| InChI | InChI=1S/C18H20N8O3/c27-26(28)14-3-1-2-13(10-14)23-17-16-15(21-12-22-17)11-20-18(24-16)19-4-5-25-6-8-29-9-7-25/h1-3,10-12H,4-9H2,(H,19,20,24)(H,21,22,23) |
| InChIKey | NSHFVUDIWPDDAX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 131.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|