C19H21N7O3 — CID 19709287
4-[methyl-[4-(3-nitroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]cyclohexan-1-ol (PubChem CID 19709287) has the molecular formula C19H21N7O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 4-[methyl-[4-(3-nitroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[methyl-[4-(3-nitroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 19709287 |
| Molecular Formula | C19H21N7O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 4-[methyl-[4-(3-nitroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]cyclohexan-1-ol |
| SMILES | CN(c1ncc2ncnc(Nc3cccc([N+](=O)[O-])c3)c2n1)C1CCC(O)CC1 |
| InChI | InChI=1S/C19H21N7O3/c1-25(13-5-7-15(27)8-6-13)19-20-10-16-17(24-19)18(22-11-21-16)23-12-3-2-4-14(9-12)26(28)29/h2-4,9-11,13,15,27H,5-8H2,1H3,(H,21,22,23) |
| InChIKey | IKIKCXODPNGHDP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 130.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|