C21H22N6O — CID 19709306
4-[[4-(3-ethynylanilino)pyrimido[5,4-d]pyrimidin-6-yl]-methylamino]cyclohexan-1-ol (PubChem CID 19709306) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is 4-[[4-(3-ethynylanilino)pyrimido[5,4-d]pyrimidin-6-yl]-methylamino]cyclohexan-1-ol.
| Compound Name | 4-[[4-(3-ethynylanilino)pyrimido[5,4-d]pyrimidin-6-yl]-methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 19709306 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 4-[[4-(3-ethynylanilino)pyrimido[5,4-d]pyrimidin-6-yl]-methylamino]cyclohexan-1-ol |
| SMILES | C#Cc1cccc(Nc2ncnc3cnc(N(C)C4CCC(O)CC4)nc23)c1 |
| InChI | InChI=1S/C21H22N6O/c1-3-14-5-4-6-15(11-14)25-20-19-18(23-13-24-20)12-22-21(26-19)27(2)16-7-9-17(28)10-8-16/h1,4-6,11-13,16-17,28H,7-10H2,2H3,(H,23,24,25) |
| InChIKey | GFXZRZMUZFAGRM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|