C21H22N4O3 — CID 58485108
5-(cyclopropylamino)-3-[2-(oxolan-2-yl)ethyl]pyrimido[4,5-c]quinoline-8-carboxylic acid (PubChem CID 58485108) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 5-(cyclopropylamino)-3-[2-(oxolan-2-yl)ethyl]pyrimido[4,5-c]quinoline-8-carboxylic acid.
| Compound Name | 5-(cyclopropylamino)-3-[2-(oxolan-2-yl)ethyl]pyrimido[4,5-c]quinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 58485108 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 5-(cyclopropylamino)-3-[2-(oxolan-2-yl)ethyl]pyrimido[4,5-c]quinoline-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(NC1CC1)c1nc(CCC3CCCO3)ncc12 |
| InChI | InChI=1S/C21H22N4O3/c26-21(27)12-3-7-15-16-11-22-18(8-6-14-2-1-9-28-14)25-19(16)20(23-13-4-5-13)24-17(15)10-12/h3,7,10-11,13-14H,1-2,4-6,8-9H2,(H,23,24)(H,26,27) |
| InChIKey | JLCVQYZELSXBBG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|