C27H36ClN3O6 — CID 143639156
methyl 2-chloro-N-[(E)-1-[4-[2-hydroxy-3-[(2-hydroxyacetyl)amino]propoxy]-3,5-dimethylphenyl]but-1-enyl]-6-propan-2-yloxypyridine-4-carboximidate (PubChem CID 143639156) has the molecular formula C27H36ClN3O6 and a molecular weight of 534.05 g/mol. Its IUPAC name is methyl 2-chloro-N-[(E)-1-[4-[2-hydroxy-3-[(2-hydroxyacetyl)amino]propoxy]-3,5-dimethylphenyl]but-1-enyl]-6-propan-2-yloxypyridine-4-carboximidate.
| Compound Name | methyl 2-chloro-N-[(E)-1-[4-[2-hydroxy-3-[(2-hydroxyacetyl)amino]propoxy]-3,5-dimethylphenyl]but-1-enyl]-6-propan-2-yloxypyridine-4-carboximidate |
|---|---|
| PubChem CID | 143639156 |
| Molecular Formula | C27H36ClN3O6 |
| Molecular Weight | 534.05 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | methyl 2-chloro-N-[(E)-1-[4-[2-hydroxy-3-[(2-hydroxyacetyl)amino]propoxy]-3,5-dimethylphenyl]but-1-enyl]-6-propan-2-yloxypyridine-4-carboximidate |
| SMILES | CC/C=C(/N=C(\OC)c1cc(Cl)nc(OC(C)C)c1)c1cc(C)c(OCC(O)CNC(=O)CO)c(C)c1 |
| InChI | InChI=1S/C27H36ClN3O6/c1-7-8-22(30-27(35-6)20-11-23(28)31-25(12-20)37-16(2)3)19-9-17(4)26(18(5)10-19)36-15-21(33)13-29-24(34)14-32/h8-12,16,21,32-33H,7,13-15H2,1-6H3,(H,29,34)/b22-8+,30-27- |
| InChIKey | GCWUCHHEWDSWON-STZUUPMWSA-N |
| XLogP | 3.83 |
| TPSA | 122.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.05 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|