C26H34N2O6 — CID 143647724
methyl N-[1-[4-[2-hydroxy-3-[(2-hydroxyacetyl)amino]propoxy]-3,5-dimethylphenyl]ethenyl]-4-propan-2-yloxybenzenecarboximidate (PubChem CID 143647724) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is methyl N-[1-[4-[2-hydroxy-3-[(2-hydroxyacetyl)amino]propoxy]-3,5-dimethylphenyl]ethenyl]-4-propan-2-yloxybenzenecarboximidate.
| Compound Name | methyl N-[1-[4-[2-hydroxy-3-[(2-hydroxyacetyl)amino]propoxy]-3,5-dimethylphenyl]ethenyl]-4-propan-2-yloxybenzenecarboximidate |
|---|---|
| PubChem CID | 143647724 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | methyl N-[1-[4-[2-hydroxy-3-[(2-hydroxyacetyl)amino]propoxy]-3,5-dimethylphenyl]ethenyl]-4-propan-2-yloxybenzenecarboximidate |
| SMILES | C=C(/N=C(\OC)c1ccc(OC(C)C)cc1)c1cc(C)c(OCC(O)CNC(=O)CO)c(C)c1 |
| InChI | InChI=1S/C26H34N2O6/c1-16(2)34-23-9-7-20(8-10-23)26(32-6)28-19(5)21-11-17(3)25(18(4)12-21)33-15-22(30)13-27-24(31)14-29/h7-12,16,22,29-30H,5,13-15H2,1-4,6H3,(H,27,31)/b28-26- |
| InChIKey | NDCDFLHIPMVZKU-SGEDCAFJSA-N |
| XLogP | 3.00 |
| TPSA | 109.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|