C28H43O3P — CID 143639288
4-[[4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methoxy]-2-phosphanylbenzene-1,3-diol (PubChem CID 143639288) has the molecular formula C28H43O3P and a molecular weight of 458.62 g/mol. Its IUPAC name is 4-[[4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methoxy]-2-phosphanylbenzene-1,3-diol.
| Compound Name | 4-[[4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methoxy]-2-phosphanylbenzene-1,3-diol |
|---|---|
| PubChem CID | 143639288 |
| Molecular Formula | C28H43O3P |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 4-[[4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methoxy]-2-phosphanylbenzene-1,3-diol |
| SMILES | CC1CCC(C2CCC(/C=C/C3CCC(COc4ccc(O)c(P)c4O)CC3)CC2)CC1 |
| InChI | InChI=1S/C28H43O3P/c1-19-2-12-23(13-3-19)24-14-10-21(11-15-24)5-4-20-6-8-22(9-7-20)18-31-26-17-16-25(29)28(32)27(26)30/h4-5,16-17,19-24,29-30H,2-3,6-15,18,32H2,1H3/b5-4+ |
| InChIKey | IGMOKLYGQQLESR-SNAWJCMRSA-N |
| XLogP | 6.97 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|