C15H27N — CID 143639582
2-tert-butyl-6-(2-methylbutan-2-yl)cyclohexa-2,5-dien-1-amine (PubChem CID 143639582) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 2-tert-butyl-6-(2-methylbutan-2-yl)cyclohexa-2,5-dien-1-amine.
| Compound Name | 2-tert-butyl-6-(2-methylbutan-2-yl)cyclohexa-2,5-dien-1-amine |
|---|---|
| PubChem CID | 143639582 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 2-tert-butyl-6-(2-methylbutan-2-yl)cyclohexa-2,5-dien-1-amine |
| SMILES | CCC(C)(C)C1=CCC=C(C(C)(C)C)C1N |
| InChI | InChI=1S/C15H27N/c1-7-15(5,6)12-10-8-9-11(13(12)16)14(2,3)4/h9-10,13H,7-8,16H2,1-6H3 |
| InChIKey | SVCDDRFIVSVHDZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|