C29H39N5O2 — CID 143641498
2-amino-6-(3-methyl-4-morpholin-4-ylphenyl)phenol;N-methyl-3-(4-methylpiperazin-1-yl)aniline (PubChem CID 143641498) has the molecular formula C29H39N5O2 and a molecular weight of 489.66 g/mol. Its IUPAC name is 2-amino-6-(3-methyl-4-morpholin-4-ylphenyl)phenol;N-methyl-3-(4-methylpiperazin-1-yl)aniline.
| Compound Name | 2-amino-6-(3-methyl-4-morpholin-4-ylphenyl)phenol;N-methyl-3-(4-methylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 143641498 |
| Molecular Formula | C29H39N5O2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | 2-amino-6-(3-methyl-4-morpholin-4-ylphenyl)phenol;N-methyl-3-(4-methylpiperazin-1-yl)aniline |
| SMILES | CNc1cccc(N2CCN(C)CC2)c1.Cc1cc(-c2cccc(N)c2O)ccc1N1CCOCC1 |
| InChI | InChI=1S/C17H20N2O2.C12H19N3/c1-12-11-13(14-3-2-4-15(18)17(14)20)5-6-16(12)19-7-9-21-10-8-19;1-13-11-4-3-5-12(10-11)15-8-6-14(2)7-9-15/h2-6,11,20H,7-10,18H2,1H3;3-5,10,13H,6-9H2,1-2H3 |
| InChIKey | LKRXRKHGNGKZLH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|