C40H47N5O5S — CID 143643457
1-acetyl-N-[1-carbamoyl-2-[(Z)-7-(2-sulfanylanilino)hept-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide;7-methoxy-2-phenyl-1H-quinolin-4-one (PubChem CID 143643457) has the molecular formula C40H47N5O5S and a molecular weight of 709.91 g/mol. Its IUPAC name is 1-acetyl-N-[1-carbamoyl-2-[(Z)-7-(2-sulfanylanilino)hept-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide;7-methoxy-2-phenyl-1H-quinolin-4-one.
| Compound Name | 1-acetyl-N-[1-carbamoyl-2-[(Z)-7-(2-sulfanylanilino)hept-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide;7-methoxy-2-phenyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 143643457 |
| Molecular Formula | C40H47N5O5S |
| Molecular Weight | 709.91 g/mol |
| Exact Mass | 709.33 |
| IUPAC Name | 1-acetyl-N-[1-carbamoyl-2-[(Z)-7-(2-sulfanylanilino)hept-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide;7-methoxy-2-phenyl-1H-quinolin-4-one |
| SMILES | CC(=O)N1CCCC1C(=O)NC1(C(N)=O)CC1/C=C\CCCCCNc1ccccc1S.COc1ccc2c(=O)cc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C24H34N4O3S.C16H13NO2/c1-17(29)28-15-9-12-20(28)22(30)27-24(23(25)31)16-18(24)10-5-3-2-4-8-14-26-19-11-6-7-13-21(19)32;1-19-12-7-8-13-15(9-12)17-14(10-16(13)18)11-5-3-2-4-6-11/h5-7,10-11,13,18,20,26,32H,2-4,8-9,12,14-16H2,1H3,(H2,25,31)(H,27,30);2-10H,1H3,(H,17,18)/b10-5-; |
| InChIKey | CFCRJYJUBNWNIR-WIMVAJRLSA-N |
| XLogP | 6.08 |
| TPSA | 146.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.91 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|