C35H44N4O6 — CID 143897617
7-methoxy-2-phenyl-1H-quinolin-4-one;methyl 2-[(Z,8S)-8-amino-9-(2-carbamoylpyrrolidin-1-yl)-9-oxonon-1-enyl]cyclopropane-1-carboxylate (PubChem CID 143897617) has the molecular formula C35H44N4O6 and a molecular weight of 616.76 g/mol. Its IUPAC name is 7-methoxy-2-phenyl-1H-quinolin-4-one;methyl 2-[(Z,8S)-8-amino-9-(2-carbamoylpyrrolidin-1-yl)-9-oxonon-1-enyl]cyclopropane-1-carboxylate.
| Compound Name | 7-methoxy-2-phenyl-1H-quinolin-4-one;methyl 2-[(Z,8S)-8-amino-9-(2-carbamoylpyrrolidin-1-yl)-9-oxonon-1-enyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 143897617 |
| Molecular Formula | C35H44N4O6 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | 7-methoxy-2-phenyl-1H-quinolin-4-one;methyl 2-[(Z,8S)-8-amino-9-(2-carbamoylpyrrolidin-1-yl)-9-oxonon-1-enyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1CC1/C=C\CCCCC[C@H](N)C(=O)N1CCCC1C(N)=O.COc1ccc2c(=O)cc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C19H31N3O4.C16H13NO2/c1-26-19(25)14-12-13(14)8-5-3-2-4-6-9-15(20)18(24)22-11-7-10-16(22)17(21)23;1-19-12-7-8-13-15(9-12)17-14(10-16(13)18)11-5-3-2-4-6-11/h5,8,13-16H,2-4,6-7,9-12,20H2,1H3,(H2,21,23);2-10H,1H3,(H,17,18)/b8-5-;/t13?,14?,15-,16?;/m0./s1 |
| InChIKey | PMHAXKPBBFDINO-RGZKIHLJSA-N |
| XLogP | 4.31 |
| TPSA | 157.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|