C25H23F3N4O2 — CID 143645271
3-[[(1-benzylbenzimidazol-2-yl)-hydroxymethyl]amino]-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 143645271) has the molecular formula C25H23F3N4O2 and a molecular weight of 468.48 g/mol. Its IUPAC name is 3-[[(1-benzylbenzimidazol-2-yl)-hydroxymethyl]amino]-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[[(1-benzylbenzimidazol-2-yl)-hydroxymethyl]amino]-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 143645271 |
| Molecular Formula | C25H23F3N4O2 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3-[[(1-benzylbenzimidazol-2-yl)-hydroxymethyl]amino]-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCNC(O)c1nc2ccccc2n1Cc1ccccc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H23F3N4O2/c26-25(27,28)18-10-12-19(13-11-18)30-22(33)14-15-29-24(34)23-31-20-8-4-5-9-21(20)32(23)16-17-6-2-1-3-7-17/h1-13,24,29,34H,14-16H2,(H,30,33) |
| InChIKey | WVDNNWWMMALMER-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|