C23H41N3O5 — CID 143645766
ethane;N-[2-[ethyl(2,2,3,3-tetramethylbutyl)amino]ethyl]-4-nitrobenzamide;methyl formate (PubChem CID 143645766) has the molecular formula C23H41N3O5 and a molecular weight of 439.60 g/mol. Its IUPAC name is ethane;N-[2-[ethyl(2,2,3,3-tetramethylbutyl)amino]ethyl]-4-nitrobenzamide;methyl formate.
| Compound Name | ethane;N-[2-[ethyl(2,2,3,3-tetramethylbutyl)amino]ethyl]-4-nitrobenzamide;methyl formate |
|---|---|
| PubChem CID | 143645766 |
| Molecular Formula | C23H41N3O5 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | ethane;N-[2-[ethyl(2,2,3,3-tetramethylbutyl)amino]ethyl]-4-nitrobenzamide;methyl formate |
| SMILES | CC.CCN(CCNC(=O)c1ccc([N+](=O)[O-])cc1)CC(C)(C)C(C)(C)C.COC=O |
| InChI | InChI=1S/C19H31N3O3.C2H4O2.C2H6/c1-7-21(14-19(5,6)18(2,3)4)13-12-20-17(23)15-8-10-16(11-9-15)22(24)25;1-4-2-3;1-2/h8-11H,7,12-14H2,1-6H3,(H,20,23);2H,1H3;1-2H3 |
| InChIKey | AKXIOWKSPMPRNQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|