C14H24O2 — CID 143646940
(2Z,4Z,6E)-8-tert-butylperoxy-8-methylnona-2,4,6-triene (PubChem CID 143646940) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (2Z,4Z,6E)-8-tert-butylperoxy-8-methylnona-2,4,6-triene.
| Compound Name | (2Z,4Z,6E)-8-tert-butylperoxy-8-methylnona-2,4,6-triene |
|---|---|
| PubChem CID | 143646940 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (2Z,4Z,6E)-8-tert-butylperoxy-8-methylnona-2,4,6-triene |
| SMILES | C/C=C\C=C/C=C/C(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C14H24O2/c1-7-8-9-10-11-12-14(5,6)16-15-13(2,3)4/h7-12H,1-6H3/b8-7-,10-9-,12-11+ |
| InChIKey | JRSOLPQIRNSMBF-PWLDKSICSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|