C16H34O6 — CID 157235691
2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene;hydrogen peroxide (PubChem CID 157235691) has the molecular formula C16H34O6 and a molecular weight of 322.44 g/mol. Its IUPAC name is 2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene;hydrogen peroxide.
| Compound Name | 2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene;hydrogen peroxide |
|---|---|
| PubChem CID | 157235691 |
| Molecular Formula | C16H34O6 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene;hydrogen peroxide |
| SMILES | CC(C)(C)OOC(C)(C)C=CC(C)(C)OOC(C)(C)C.OO |
| InChI | InChI=1S/C16H32O4.H2O2/c1-13(2,3)17-19-15(7,8)11-12-16(9,10)20-18-14(4,5)6;1-2/h11-12H,1-10H3;1-2H |
| InChIKey | AUPMEHLZGWJWGU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|