About (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene
(E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene (PubChem CID 11659272) has the molecular formula C16H32O4
and a molecular weight of 288.43 g/mol. Its IUPAC name is (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene.
Molecular Properties
| Compound Name | (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene |
| PubChem CID | 11659272 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene |
| SMILES | CC(C)(C)OOC(C)(C)/C=C/C(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C16H32O4/c1-13(2,3)17-19-15(7,8)11-12-16(9,10)20-18-14(4,5)6/h11-12H,1-10H3/b12-11+ |
| InChIKey | VVFNNEKHSFZNKA-VAWYXSNFSA-N |
| XLogP | 4.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene?
The IUPAC name of (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene (CID 11659272) is (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene.
What is the SMILES notation for (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene?
The canonical SMILES for (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene is CC(C)(C)OOC(C)(C)/C=C/C(C)(C)OOC(C)(C)C.
What is the InChIKey of (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene?
The InChIKey is VVFNNEKHSFZNKA-VAWYXSNFSA-N. The full InChI is InChI=1S/C16H32O4/c1-13(2,3)17-19-15(7,8)11-12-16(9,10)20-18-14(4,5)6/h11-12H,1-10H3/b12-11+.
What are the key properties of (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene?
(E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene has a molecular weight of 288.43 g/mol, XLogP of 4.59, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene is sourced from PubChem (CID 11659272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).