C16H32O4 — CID 11659272
(E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene (PubChem CID 11659272) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene.
| Compound Name | (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene |
|---|---|
| PubChem CID | 11659272 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | (E)-2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-ene |
| SMILES | CC(C)(C)OOC(C)(C)/C=C/C(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C16H32O4/c1-13(2,3)17-19-15(7,8)11-12-16(9,10)20-18-14(4,5)6/h11-12H,1-10H3/b12-11+ |
| InChIKey | VVFNNEKHSFZNKA-VAWYXSNFSA-N |
| XLogP | 4.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|