C13H28O4 — CID 20542110
3,3-bis(tert-butylperoxy)pentane (PubChem CID 20542110) has the molecular formula C13H28O4 and a molecular weight of 248.36 g/mol. Its IUPAC name is 3,3-bis(tert-butylperoxy)pentane.
| Compound Name | 3,3-bis(tert-butylperoxy)pentane |
|---|---|
| PubChem CID | 20542110 |
| Molecular Formula | C13H28O4 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 3,3-bis(tert-butylperoxy)pentane |
| SMILES | CCC(CC)(OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C13H28O4/c1-9-13(10-2,16-14-11(3,4)5)17-15-12(6,7)8/h9-10H2,1-8H3 |
| InChIKey | JZQAIPKOAZJLET-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|