C20H42O4 — CID 139956837
2,2,3-trimethyl-3-[3-(2,3,3-trimethylbutan-2-ylperoxy)hexan-3-ylperoxy]butane (PubChem CID 139956837) has the molecular formula C20H42O4 and a molecular weight of 346.55 g/mol. Its IUPAC name is 2,2,3-trimethyl-3-[3-(2,3,3-trimethylbutan-2-ylperoxy)hexan-3-ylperoxy]butane.
| Compound Name | 2,2,3-trimethyl-3-[3-(2,3,3-trimethylbutan-2-ylperoxy)hexan-3-ylperoxy]butane |
|---|---|
| PubChem CID | 139956837 |
| Molecular Formula | C20H42O4 |
| Molecular Weight | 346.55 g/mol |
| Exact Mass | 346.31 |
| IUPAC Name | 2,2,3-trimethyl-3-[3-(2,3,3-trimethylbutan-2-ylperoxy)hexan-3-ylperoxy]butane |
| SMILES | CCCC(CC)(OOC(C)(C)C(C)(C)C)OOC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O4/c1-13-15-20(14-2,23-21-18(9,10)16(3,4)5)24-22-19(11,12)17(6,7)8/h13-15H2,1-12H3 |
| InChIKey | XLDBTIPNVABVNT-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.55 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|