C24H50O4 — CID 139956870
3,3-bis(2,4,4-trimethylpentan-2-ylperoxy)octane (PubChem CID 139956870) has the molecular formula C24H50O4 and a molecular weight of 402.66 g/mol. Its IUPAC name is 3,3-bis(2,4,4-trimethylpentan-2-ylperoxy)octane.
| Compound Name | 3,3-bis(2,4,4-trimethylpentan-2-ylperoxy)octane |
|---|---|
| PubChem CID | 139956870 |
| Molecular Formula | C24H50O4 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.37 |
| IUPAC Name | 3,3-bis(2,4,4-trimethylpentan-2-ylperoxy)octane |
| SMILES | CCCCCC(CC)(OOC(C)(C)CC(C)(C)C)OOC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C24H50O4/c1-13-15-16-17-24(14-2,27-25-22(9,10)18-20(3,4)5)28-26-23(11,12)19-21(6,7)8/h13-19H2,1-12H3 |
| InChIKey | FLCMICPHEABGCU-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|