C21H44O4 — CID 139956808
4,4-bis(2,3-dimethylbutan-2-ylperoxy)nonane (PubChem CID 139956808) has the molecular formula C21H44O4 and a molecular weight of 360.58 g/mol. Its IUPAC name is 4,4-bis(2,3-dimethylbutan-2-ylperoxy)nonane.
| Compound Name | 4,4-bis(2,3-dimethylbutan-2-ylperoxy)nonane |
|---|---|
| PubChem CID | 139956808 |
| Molecular Formula | C21H44O4 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.32 |
| IUPAC Name | 4,4-bis(2,3-dimethylbutan-2-ylperoxy)nonane |
| SMILES | CCCCCC(CCC)(OOC(C)(C)C(C)C)OOC(C)(C)C(C)C |
| InChI | InChI=1S/C21H44O4/c1-11-13-14-16-21(15-12-2,24-22-19(7,8)17(3)4)25-23-20(9,10)18(5)6/h17-18H,11-16H2,1-10H3 |
| InChIKey | WPSNZMJPYKJAEX-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|