C16H34O4 — CID 139956822
4,4-bis(tert-butylperoxy)octane (PubChem CID 139956822) has the molecular formula C16H34O4 and a molecular weight of 290.44 g/mol. Its IUPAC name is 4,4-bis(tert-butylperoxy)octane.
| Compound Name | 4,4-bis(tert-butylperoxy)octane |
|---|---|
| PubChem CID | 139956822 |
| Molecular Formula | C16H34O4 |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 4,4-bis(tert-butylperoxy)octane |
| SMILES | CCCCC(CCC)(OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C16H34O4/c1-9-11-13-16(12-10-2,19-17-14(3,4)5)20-18-15(6,7)8/h9-13H2,1-8H3 |
| InChIKey | QGITZQIIWLUNKD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|