C22H42O4 — CID 18938676
5,8-bis(tert-butylperoxy)-5,8-dimethyldodec-6-yne (PubChem CID 18938676) has the molecular formula C22H42O4 and a molecular weight of 370.57 g/mol. Its IUPAC name is 5,8-bis(tert-butylperoxy)-5,8-dimethyldodec-6-yne.
| Compound Name | 5,8-bis(tert-butylperoxy)-5,8-dimethyldodec-6-yne |
|---|---|
| PubChem CID | 18938676 |
| Molecular Formula | C22H42O4 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | 5,8-bis(tert-butylperoxy)-5,8-dimethyldodec-6-yne |
| SMILES | CCCCC(C)(C#CC(C)(CCCC)OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C22H42O4/c1-11-13-15-21(9,25-23-19(3,4)5)17-18-22(10,16-14-12-2)26-24-20(6,7)8/h11-16H2,1-10H3 |
| InChIKey | UUZMLFLRKPHCNR-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|