C22H46O4 — CID 139956857
4,4-bis(2,3,3-trimethylbutan-2-ylperoxy)octane (PubChem CID 139956857) has the molecular formula C22H46O4 and a molecular weight of 374.61 g/mol. Its IUPAC name is 4,4-bis(2,3,3-trimethylbutan-2-ylperoxy)octane.
| Compound Name | 4,4-bis(2,3,3-trimethylbutan-2-ylperoxy)octane |
|---|---|
| PubChem CID | 139956857 |
| Molecular Formula | C22H46O4 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.34 |
| IUPAC Name | 4,4-bis(2,3,3-trimethylbutan-2-ylperoxy)octane |
| SMILES | CCCCC(CCC)(OOC(C)(C)C(C)(C)C)OOC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O4/c1-13-15-17-22(16-14-2,25-23-20(9,10)18(3,4)5)26-24-21(11,12)19(6,7)8/h13-17H2,1-12H3 |
| InChIKey | KRNXUDJNFFBPFI-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|