C22H25FN2O4 — CID 143647690
4-cyclopropyl-6-methoxyquinolin-7-ol;ethane;2-fluoro-1-methyl-4-nitrobenzene (PubChem CID 143647690) has the molecular formula C22H25FN2O4 and a molecular weight of 400.45 g/mol. Its IUPAC name is 4-cyclopropyl-6-methoxyquinolin-7-ol;ethane;2-fluoro-1-methyl-4-nitrobenzene.
| Compound Name | 4-cyclopropyl-6-methoxyquinolin-7-ol;ethane;2-fluoro-1-methyl-4-nitrobenzene |
|---|---|
| PubChem CID | 143647690 |
| Molecular Formula | C22H25FN2O4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 4-cyclopropyl-6-methoxyquinolin-7-ol;ethane;2-fluoro-1-methyl-4-nitrobenzene |
| SMILES | CC.COc1cc2c(C3CC3)ccnc2cc1O.Cc1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C13H13NO2.C7H6FNO2.C2H6/c1-16-13-6-10-9(8-2-3-8)4-5-14-11(10)7-12(13)15;1-5-2-3-6(9(10)11)4-7(5)8;1-2/h4-8,15H,2-3H2,1H3;2-4H,1H3;1-2H3 |
| InChIKey | CMBHOJCPFJFWEV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|