About ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate
ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate (PubChem CID 143647993) has the molecular formula C21H30N2O4S
and a molecular weight of 406.55 g/mol. Its IUPAC name is ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate |
| PubChem CID | 143647993 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate |
| SMILES | CC.COC(=O)c1ccc2c(c1)c1c(n2S(C)=O)CCN(C2CCOCC2)C1 |
| InChI | InChI=1S/C19H24N2O4S.C2H6/c1-24-19(22)13-3-4-17-15(11-13)16-12-20(14-6-9-25-10-7-14)8-5-18(16)21(17)26(2)23;1-2/h3-4,11,14H,5-10,12H2,1-2H3;1-2H3 |
| InChIKey | FJIXXKZRHNZWAR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate?
The IUPAC name of ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate (CID 143647993) is ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate.
What is the SMILES notation for ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate?
The canonical SMILES for ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate is CC.COC(=O)c1ccc2c(c1)c1c(n2S(C)=O)CCN(C2CCOCC2)C1.
What is the InChIKey of ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate?
The InChIKey is FJIXXKZRHNZWAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O4S.C2H6/c1-24-19(22)13-3-4-17-15(11-13)16-12-20(14-6-9-25-10-7-14)8-5-18(16)21(17)26(2)23;1-2/h3-4,11,14H,5-10,12H2,1-2H3;1-2H3.
What are the key properties of ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate?
ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate has a molecular weight of 406.55 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 5-methylsulfinyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate is sourced from PubChem (CID 143647993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).