C25H35N3O2 — CID 59316076
(4,4-dimethylpiperidin-1-yl)-[5-methyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone (PubChem CID 59316076) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is (4,4-dimethylpiperidin-1-yl)-[5-methyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone.
| Compound Name | (4,4-dimethylpiperidin-1-yl)-[5-methyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone |
|---|---|
| PubChem CID | 59316076 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | (4,4-dimethylpiperidin-1-yl)-[5-methyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone |
| SMILES | Cn1c2c(c3cc(C(=O)N4CCC(C)(C)CC4)ccc31)CN(C1CCOCC1)CC2 |
| InChI | InChI=1S/C25H35N3O2/c1-25(2)9-12-27(13-10-25)24(29)18-4-5-22-20(16-18)21-17-28(11-6-23(21)26(22)3)19-7-14-30-15-8-19/h4-5,16,19H,6-15,17H2,1-3H3 |
| InChIKey | AQBOFTWRMLZDBS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|