C27H35N3O3 — CID 25195562
(3R)-N-cyclopropyl-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]pyrrolidine-3-carboxamide (PubChem CID 25195562) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is (3R)-N-cyclopropyl-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-cyclopropyl-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 25195562 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | (3R)-N-cyclopropyl-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]pyrrolidine-3-carboxamide |
| SMILES | Cn1c2c(c3cc(C(=O)N4CC[C@@H](C(=O)NC5CC5)C4)ccc31)CC(C1CCOCC1)CC2 |
| InChI | InChI=1S/C27H35N3O3/c1-29-24-6-2-18(17-9-12-33-13-10-17)14-22(24)23-15-19(3-7-25(23)29)27(32)30-11-8-20(16-30)26(31)28-21-4-5-21/h3,7,15,17-18,20-21H,2,4-6,8-14,16H2,1H3,(H,28,31)/t18?,20-/m1/s1 |
| InChIKey | DTGWWAAVNSXPFQ-ROPPNANJSA-N |
| XLogP | 3.45 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|