C49H65N3O7 — CID 158950580
tert-butyl 2-[1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]piperidin-3-yl]acetate;9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 158950580) has the molecular formula C49H65N3O7 and a molecular weight of 808.07 g/mol. Its IUPAC name is tert-butyl 2-[1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]piperidin-3-yl]acetate;9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | tert-butyl 2-[1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]piperidin-3-yl]acetate;9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 158950580 |
| Molecular Formula | C49H65N3O7 |
| Molecular Weight | 808.07 g/mol |
| Exact Mass | 807.48 |
| IUPAC Name | tert-butyl 2-[1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]piperidin-3-yl]acetate;9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | Cn1c2c(c3cc(C(=O)N4CCCC(CC(=O)OC(C)(C)C)C4)ccc31)CC(C1CCOCC1)CC2.Cn1c2c(c3cc(C(=O)O)ccc31)CC(C1CCOCC1)CC2 |
| InChI | InChI=1S/C30H42N2O4.C19H23NO3/c1-30(2,3)36-28(33)16-20-6-5-13-32(19-20)29(34)23-8-10-27-25(18-23)24-17-22(7-9-26(24)31(27)4)21-11-14-35-15-12-21;1-20-17-4-2-13(12-6-8-23-9-7-12)10-15(17)16-11-14(19(21)22)3-5-18(16)20/h8,10,18,20-22H,5-7,9,11-17,19H2,1-4H3;3,5,11-13H,2,4,6-10H2,1H3,(H,21,22) |
| InChIKey | JLJIHGRQARMFLJ-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.07 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|