C45H59N3O6 — CID 159296235
N-ethyl-9-methyl-6-(oxan-4-yl)-N-(2-oxopentyl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide;9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 159296235) has the molecular formula C45H59N3O6 and a molecular weight of 737.98 g/mol. Its IUPAC name is N-ethyl-9-methyl-6-(oxan-4-yl)-N-(2-oxopentyl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide;9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | N-ethyl-9-methyl-6-(oxan-4-yl)-N-(2-oxopentyl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide;9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 159296235 |
| Molecular Formula | C45H59N3O6 |
| Molecular Weight | 737.98 g/mol |
| Exact Mass | 737.44 |
| IUPAC Name | N-ethyl-9-methyl-6-(oxan-4-yl)-N-(2-oxopentyl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide;9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | CCCC(=O)CN(CC)C(=O)c1ccc2c(c1)c1c(n2C)CCC(C2CCOCC2)C1.Cn1c2c(c3cc(C(=O)O)ccc31)CC(C1CCOCC1)CC2 |
| InChI | InChI=1S/C26H36N2O3.C19H23NO3/c1-4-6-21(29)17-28(5-2)26(30)20-8-10-25-23(16-20)22-15-19(7-9-24(22)27(25)3)18-11-13-31-14-12-18;1-20-17-4-2-13(12-6-8-23-9-7-12)10-15(17)16-11-14(19(21)22)3-5-18(16)20/h8,10,16,18-19H,4-7,9,11-15,17H2,1-3H3;3,5,11-13H,2,4,6-10H2,1H3,(H,21,22) |
| InChIKey | LATJFRHPBABWIO-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.98 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|