C26H35FN2O3 — CID 58326254
N-ethyl-N-(5-fluoro-2-oxopentyl)-9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide (PubChem CID 58326254) has the molecular formula C26H35FN2O3 and a molecular weight of 442.58 g/mol. Its IUPAC name is N-ethyl-N-(5-fluoro-2-oxopentyl)-9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide.
| Compound Name | N-ethyl-N-(5-fluoro-2-oxopentyl)-9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 58326254 |
| Molecular Formula | C26H35FN2O3 |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | N-ethyl-N-(5-fluoro-2-oxopentyl)-9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
| SMILES | CCN(CC(=O)CCCF)C(=O)c1ccc2c(c1)c1c(n2C)CCC(C2CCOCC2)C1 |
| InChI | InChI=1S/C26H35FN2O3/c1-3-29(17-21(30)5-4-12-27)26(31)20-7-9-25-23(16-20)22-15-19(6-8-24(22)28(25)2)18-10-13-32-14-11-18/h7,9,16,18-19H,3-6,8,10-15,17H2,1-2H3 |
| InChIKey | BLWYRFDBASIFCE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|