C27H38N4O2S — CID 25196550
N-[2-[cyclopropylcarbamothioyl(methyl)amino]ethyl]-N,9-dimethyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide (PubChem CID 25196550) has the molecular formula C27H38N4O2S and a molecular weight of 482.69 g/mol. Its IUPAC name is N-[2-[cyclopropylcarbamothioyl(methyl)amino]ethyl]-N,9-dimethyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide.
| Compound Name | N-[2-[cyclopropylcarbamothioyl(methyl)amino]ethyl]-N,9-dimethyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 25196550 |
| Molecular Formula | C27H38N4O2S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | N-[2-[cyclopropylcarbamothioyl(methyl)amino]ethyl]-N,9-dimethyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
| SMILES | CN(CCN(C)C(=S)NC1CC1)C(=O)c1ccc2c(c1)c1c(n2C)CCC(C2CCOCC2)C1 |
| InChI | InChI=1S/C27H38N4O2S/c1-29(12-13-30(2)27(34)28-21-6-7-21)26(32)20-5-9-25-23(17-20)22-16-19(4-8-24(22)31(25)3)18-10-14-33-15-11-18/h5,9,17-19,21H,4,6-8,10-16H2,1-3H3,(H,28,34) |
| InChIKey | IWQGWTNNIYKSGG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|