C27H39N3O4 — CID 67252003
N-ethyl-N-[4-(2-hydroxyethylamino)-4-oxobutyl]-9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide (PubChem CID 67252003) has the molecular formula C27H39N3O4 and a molecular weight of 469.63 g/mol. Its IUPAC name is N-ethyl-N-[4-(2-hydroxyethylamino)-4-oxobutyl]-9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide.
| Compound Name | N-ethyl-N-[4-(2-hydroxyethylamino)-4-oxobutyl]-9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 67252003 |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | N-ethyl-N-[4-(2-hydroxyethylamino)-4-oxobutyl]-9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
| SMILES | CCN(CCCC(=O)NCCO)C(=O)c1ccc2c(c1)c1c(n2C)CCC(C2CCOCC2)C1 |
| InChI | InChI=1S/C27H39N3O4/c1-3-30(13-4-5-26(32)28-12-14-31)27(33)21-7-9-25-23(18-21)22-17-20(6-8-24(22)29(25)2)19-10-15-34-16-11-19/h7,9,18-20,31H,3-6,8,10-17H2,1-2H3,(H,28,32) |
| InChIKey | NTDCJCJMRHYSCZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|