C27H38N4O4 — CID 25195992
3-N-ethyl-3-N-[2-(ethylamino)-2-oxoethyl]-9-N,9-N-dimethyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3,9-dicarboxamide (PubChem CID 25195992) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is 3-N-ethyl-3-N-[2-(ethylamino)-2-oxoethyl]-9-N,9-N-dimethyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3,9-dicarboxamide.
| Compound Name | 3-N-ethyl-3-N-[2-(ethylamino)-2-oxoethyl]-9-N,9-N-dimethyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3,9-dicarboxamide |
|---|---|
| PubChem CID | 25195992 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 3-N-ethyl-3-N-[2-(ethylamino)-2-oxoethyl]-9-N,9-N-dimethyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3,9-dicarboxamide |
| SMILES | CCNC(=O)CN(CC)C(=O)c1ccc2c(c1)c1c(n2C(=O)N(C)C)CCC(C2CCOCC2)C1 |
| InChI | InChI=1S/C27H38N4O4/c1-5-28-25(32)17-30(6-2)26(33)20-8-10-24-22(16-20)21-15-19(18-11-13-35-14-12-18)7-9-23(21)31(24)27(34)29(3)4/h8,10,16,18-19H,5-7,9,11-15,17H2,1-4H3,(H,28,32) |
| InChIKey | LGHPQVITSUAEQC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |